Polyether polyol CAS#9082-00-2
Low-Foaming Performance: Ideal for use in low-foaming detergents and defoaming applications, ensuring efficient processing.
Excellent Emulsifying Capability: Functions effectively as an emulsifier across various industrial formulations.
Wide Functional Versatility: Suitable for detergents, lubricants, adhesives, antistatic agents, fabric leveling agents, and metal cutting coolants.
Industrial Process Efficiency: Supports high-speed spinning oils and lubrication systems, improving operational stability and performance.
Polyether polyol (CAS# 9082-00-2) is a colorless to light yellow, viscous liquid polymer primarily used as a raw material in manufacturing flexible and rigid polyurethane (PU) foams, sealants, and elastomers. It is a glycerol-initiated ethylene oxide-propylene oxide (EO-PO) copolymer, commonly used for high-resilience foam, furniture, and auto seats.
| English Name | GLYCEROL PROPOXYLATE-B-ETHOXYLATE |
| English Synonyms | GLYCEROL PROPOXYLATE-B-ETHOXYLATE;1,2,3-Propanetriol,polymerwithmethyloxiraneandoxirane;Glycero l,ethyleneoxide,propyleneoxidepolymer;Glycerol,propyleneoxide,ethyleneoxidepolymer;Glycerolpoly(oxyet hylene,oxypropylene)ether;Oxirane,methyl-,polymerwithoxirane,etherwith1,2,3-propanetriol(3:1);Glycerol p olyethylene-propylene glycol ether;Glycerol propoxylate-block-ethoxylate average Mn -4,000 |
| CAS Number | 9082-00-2 |
| Molecular Formula | C8H2207 |
| Molecular Weight | 194.23 |
| EINECS Number | 208-750-2 |
| Density | 1.02 g/mL at 25 °C |
| Vapor density | >1 (vs air) |
| Vapor pressure | <0.3 mm Hg (20 °C) |
| Flash point | >230 °F |
| Solubility | H20: <0.1 %(w/w)at 25°C |
| Form | liquid |
| Water solubility | H2O: <0.1% (w/w) at25°C |
| InChI | InChI=1S/C3H803.C3H6O.C2H40/c4-1-3(6)2-5;1-3-2-4-3;1-2-3-1/h3-6H,1-2H2;3H,2H2,1H3;1-2H2 |
| InChI key | CESZUODSLPRJDU-UHFFFAOYSA-N |
| Smiles | C(O)(CO)CO.C1OC1.CC1OC1 |
Polymers of methyl ethylene oxide with ethylene oxide and 1,2,3-propanetriol can be used in low-foaming detergents, emulsifiers, defoamers, fabric leveling agents, antistatic agents, metal cutting coolants, high-speed spinning oils, lubricants, and adhesives.
