5-Bromo-2-chloropyrimidine CAS#32779-36-5
Valuable Pharmaceutical Intermediate: Widely used in the synthesis of macitentan, an endothelin receptor antagonist for pulmonary hypertension treatment.
Reactive Halogenated Structure: Contains both chloro and bromo substituents, enabling versatile chemical transformations and functionalization.
High Synthetic Utility: The pyrimidine core structure supports efficient incorporation into complex drug molecules.
Supports Advanced Drug Development: Facilitates the production of targeted therapeutic agents, making it important for modern pharmaceutical research.
5-Bromo-2-chloropyrimidine Chemical Properties
| Melting point | 73-79 °C (lit.) |
| Boiling point | 95°C 15mm |
| density | 1.859±0.06 g/cm3(Predicted) |
| Fp | 95°C/15mm |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| pka | -2.84±0.22(Predicted) |
| form | Crystalline Powder |
| color | Off-white to beige |
| Water Solubility | insoluble |
| BRN | 507955 |
| Stability: | Hygroscopic |
| InChI | InChI=1S/C4H2BrClN2/c5-3-1-7-4(6)8-2-3/h1-2H |
| InChIKey | XPGIBDJXEVAVTO-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC=C(Br)C=N1 |
| CAS DataBase Reference | 32779-36-5(CAS DataBase Reference) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/39-37/39-36 |
| RIDADR | UN 3335 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29335990 |
Product Applications of 5-Bromo-2-chloropyrimidine (CAS No. 32779-36-5)
5-Bromo-2-chloropyrimidine is used as a pharmaceutical intermediate in the synthesis of various drug compounds, including inhibitors. It is also utilized in cross-coupling reactions involving indium organometallic reagents with 2,5-dihalopyrimidines.
