6-Benzylaminopurine CAS#1214-39-7
Effective Plant Growth Regulator: 6-Benzylaminopurine promotes and regulates plant growth in various agricultural applications.
Synthetic Cytokinin: It belongs to the first generation of synthetic cytokinins, providing reliable and controlled activity.
Wide Agricultural Use: The compound is suitable for use across diverse crops and agricultural commodities.
Enhances Crop Productivity: By regulating growth, it helps improve yield and overall plant development.
6-Benzylaminopurine Chemical Properties
| Melting point | 230-233 °C |
| Boiling point | 145 °C(lit.) |
| Density | 0.899 g/mL at 20 °C |
| Vapor density | >1 (vs air) |
| Vapor pressure | 3.3 mm Hg ( 20 °C) |
| Refractive index | n20/D 1.418(lit.) |
| Fp | 103 °F |
| Storage temp. | 2-8°C |
| Solubility | H2O: soluble |
| Form | Liquid |
| Pka | 9.36±0.20(Predicted) |
| Color | White to very faint yellow |
| Odor | Characteristic acrylic. |
| Water Solubility | Soluble in water, methanol and acetone. Slightly soluble in ethyl acetate and dichloromethane and toluene. Insoluble in n-hexane. |
| BRN | 19406 |
| Stability | Stable. Incompatible with strong oxidizing agents. |
| Major Application | food and beverages |
| Cosmetics Ingredients Functions | HAIR CONDITIONING |
| InChI | 1S/C12H11N5/c1-2-4-9(5-3-1)6-13-11-10-12(15-7-14-10)17-8-16-11/h1-5,7-8H,6H2,(H2,13,14,15,16,17) |
| InChIKey | NWBJYWHLCVSVIJ-UHFFFAOYSA-N |
| SMILES | C(Nc1ncnc2nc[nH]c12)c3ccccc3 |
| LogP | 1.57 |
| CAS DataBase Reference | 1214-39-7(CAS DataBase Reference) |
| NIST Chemistry Reference | 1H-purin-6-amine, n-(phenylmethyl)-(1214-39-7) |
| EPA Substance Registry System | N-Benzyladenine (1214-39-7) |
Safety Information
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-20/21/22-22 |
| Safety Statements | 9-24/25-37/39-26-36-23 |
| RIDADR | UN 2348 3/PG 3 |
| WGK Germany | 3 |
| RTECS | UD3150000 |
| F | 8 |
| TSCA | TSCA listed |
| HS Code | 29335995 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |
| Aquatic Acute 1 | |
| Aquatic Chronic 2 | |
| Repr. 2 | |
| Hazardous Substances Data | 1214-39-7(Hazardous Substances Data) |
| Toxicity | LD50 orl-rat: 2125 mg/kg TOIZAG 19,336,72 |
Product Application of 6-Benzylaminopurine CAS#1214-39-7
6-Benzylaminopurine solution is used as an additive in Murashige & Skoog (MS) medium for culturing mandarin explants and Dendrocalamus asper (Schultes f.) plantlets. It is also employed as a supplement in Nitsch and Nitsch (NN) medium for grapevine explants.
