Olivetol CAS#500-66-3
Broad-spectrum antimicrobial activity ： Effective against fungi and bacteria.
DNA cleavage capability ： Breaks DNA in presence of copper chloride and oxygen.
Antiviral efficacy ： Inhibits retrovirus-induced immunodeficiency.
Anticancer potential ： Shows significant effects against malignant tumors.
Product Overview: Olivetol (CAS 500-66-3)
Olivetol is a bioactive compound renowned for its broad-spectrum antimicrobial and antifungal properties, effectively neutralizing diverse pathogens. Recent scientific research highlights that high concentrations of 3,5-dihydroxyalkylbenzene (Olivetol) can induce DNA cleavage in the presence of copper chloride and oxygen. Leveraging this unique mechanism, it has demonstrated significant efficacy in inhibiting and treating malignant tumors, various cancers, and retrovirus-induced human immunodeficiency.
Parameters
Melting point | 46-48 °C(lit.) |
Boiling point | 164 °C |
density | 1.068±0.06 g/cm3(Predicted) |
Fp | >230 °F |
storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
solubility | Chloroform (Slightly), Methanol (Slightly) |
form | Solid |
pka | 9.59±0.10(Predicted) |
color | Colourless to Beige |
Stability: | Light Sensitive |
InChI | InChI=1S/C11H16O2/c1-2-3-4-5-9-6-10(12)8-11(13)7-9/h6-8,12-13H,2-5H2,1H3 |
InChIKey | IRMPFYJSHJGOPE-UHFFFAOYSA-N |
SMILES | C1(O)=CC(CCCCC)=CC(O)=C1 |
CAS DataBase Reference | 500-66-3(CAS DataBase Reference) |
NIST Chemistry Reference | 1,3-Benzenediol, 5-pentyl-(500-66-3) |
EPA Substance Registry System | Olivetol (500-66-3) |
Safety Information
Hazard Codes | Xi |
Risk Statements | 36/37/38 |
Safety Statements | 26-36/39 |
WGK Germany | 3 |
RTECS | VH2880000 |
HS Code | 2907290090 |
Product Application of Olivetol (CAS# 500-66-3)
Olivetol serves as a vital pharmaceutical intermediate. It was originally derived from the degradation of lichen acids (such as D-usnic acid and amyl usnic deoxyphenolic acid) sourced from lichen plants. Its primary application today is as a crucial precursor for the synthesis of tetrahydrocannabinol (THC) derivatives in both laboratory R&D and large-scale chemical production processes.
